C26H32N2O4 — CID 46229124
(1R,4S,5R,7R)-3,4-dibenzyl-N-hexyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 46229124) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is (1R,4S,5R,7R)-3,4-dibenzyl-N-hexyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-hexyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 46229124 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-hexyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CCCCCCNC(=O)[C@@H]1O[C@@H]2O[C@H]1C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C26H32N2O4/c1-2-3-4-11-16-27-24(29)22-23-25(30)28(18-20-14-9-6-10-15-20)21(26(31-22)32-23)17-19-12-7-5-8-13-19/h5-10,12-15,21-23,26H,2-4,11,16-18H2,1H3,(H,27,29)/t21-,22+,23+,26+/m0/s1 |
| InChIKey | LFBKNVJTKAKCNI-NZCWTCFWSA-N |
| XLogP | 3.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|