C25H30N2O4 — CID 46229181
(1R,4S,5R,7R)-3,4-dibenzyl-N-(3-methylbutyl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 46229181) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is (1R,4S,5R,7R)-3,4-dibenzyl-N-(3-methylbutyl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-(3-methylbutyl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 46229181 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-(3-methylbutyl)-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@@H]1O[C@@H]2O[C@H]1C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O4/c1-17(2)13-14-26-23(28)21-22-24(29)27(16-19-11-7-4-8-12-19)20(25(30-21)31-22)15-18-9-5-3-6-10-18/h3-12,17,20-22,25H,13-16H2,1-2H3,(H,26,28)/t20-,21+,22+,25+/m0/s1 |
| InChIKey | NQKZULPLCCHBGD-IYXIZZNPSA-N |
| XLogP | 2.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |