C28H32N2O6 — CID 46229184
ethyl 1-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperidine-4-carboxylate (PubChem CID 46229184) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is ethyl 1-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46229184 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | ethyl 1-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@@H]2O[C@@H]3O[C@H]2C(=O)N(Cc2ccccc2)[C@H]3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H32N2O6/c1-2-34-27(33)21-13-15-29(16-14-21)25(31)23-24-26(32)30(18-20-11-7-4-8-12-20)22(28(35-23)36-24)17-19-9-5-3-6-10-19/h3-12,21-24,28H,2,13-18H2,1H3/t22-,23+,24+,28+/m0/s1 |
| InChIKey | ZFFVNMLSCCACSR-GOIZPCHYSA-N |
| XLogP | 2.55 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |