C21H32O4 — CID 46229186
(2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-(hydroxymethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 46229186) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-(hydroxymethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-(hydroxymethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 46229186 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-(hydroxymethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | C=C([C@H]1[C@H]2CC(=O)O[C@H]2O[C@@H]1CO)[C@H]1CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C21H32O4/c1-12(18-13-10-17(23)25-19(13)24-15(18)11-22)14-6-7-16-20(2,3)8-5-9-21(14,16)4/h13-16,18-19,22H,1,5-11H2,2-4H3/t13-,14-,15-,16+,18+,19-,21-/m1/s1 |
| InChIKey | ILGCQYWVUGZROS-IMKKVUBGSA-N |
| XLogP | 3.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|