C27H31N3O6 — CID 46229196
ethyl 4-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperazine-1-carboxylate (PubChem CID 46229196) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 4-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46229196 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | ethyl 4-[(1R,4S,5R,7R)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H]2O[C@@H]3O[C@H]2C(=O)N(Cc2ccccc2)[C@H]3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O6/c1-2-34-27(33)29-15-13-28(14-16-29)24(31)22-23-25(32)30(18-20-11-7-4-8-12-20)21(26(35-22)36-23)17-19-9-5-3-6-10-19/h3-12,21-23,26H,2,13-18H2,1H3/t21-,22+,23+,26+/m0/s1 |
| InChIKey | VVSYAWMPLVFJNL-NZCWTCFWSA-N |
| XLogP | 2.05 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |