C23H27N3O4 — CID 46229197
(1R,4S,5R,7R)-N-(2-aminoethyl)-3,4-dibenzyl-N-methyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 46229197) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (1R,4S,5R,7R)-N-(2-aminoethyl)-3,4-dibenzyl-N-methyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1R,4S,5R,7R)-N-(2-aminoethyl)-3,4-dibenzyl-N-methyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 46229197 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (1R,4S,5R,7R)-N-(2-aminoethyl)-3,4-dibenzyl-N-methyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CN(CCN)C(=O)[C@@H]1O[C@@H]2O[C@H]1C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C23H27N3O4/c1-25(13-12-24)21(27)19-20-22(28)26(15-17-10-6-3-7-11-17)18(23(29-19)30-20)14-16-8-4-2-5-9-16/h2-11,18-20,23H,12-15,24H2,1H3/t18-,19+,20+,23+/m0/s1 |
| InChIKey | UXXPXURVHDXKTL-DZCCDHAISA-N |
| XLogP | 1.17 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |