C26H32N2O5 — CID 46229198
(1R,4S,5R,7R)-3,4-dibenzyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide (PubChem CID 46229198) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is (1R,4S,5R,7R)-3,4-dibenzyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide.
| Compound Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
|---|---|
| PubChem CID | 46229198 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (1R,4S,5R,7R)-3,4-dibenzyl-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)[C@@H]1O[C@@H]2O[C@H]1C(=O)N(Cc1ccccc1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C26H32N2O5/c1-17(2)13-20(16-29)27-24(30)22-23-25(31)28(15-19-11-7-4-8-12-19)21(26(32-22)33-23)14-18-9-5-3-6-10-18/h3-12,17,20-23,26,29H,13-16H2,1-2H3,(H,27,30)/t20-,21-,22+,23+,26+/m0/s1 |
| InChIKey | YZRBDOPVWVBWRR-NDRZJSJOSA-N |
| XLogP | 2.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |