C14H20O5 — CID 46229207
[(2R,3R,3aR,6aR)-3-(3,3-dimethylbut-1-en-2-yl)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate (PubChem CID 46229207) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is [(2R,3R,3aR,6aR)-3-(3,3-dimethylbut-1-en-2-yl)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate.
| Compound Name | [(2R,3R,3aR,6aR)-3-(3,3-dimethylbut-1-en-2-yl)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
|---|---|
| PubChem CID | 46229207 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [(2R,3R,3aR,6aR)-3-(3,3-dimethylbut-1-en-2-yl)-5-oxo-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-2-yl] acetate |
| SMILES | C=C([C@@H]1[C@@H](OC(C)=O)O[C@@H]2OC(=O)C[C@@H]21)C(C)(C)C |
| InChI | InChI=1S/C14H20O5/c1-7(14(3,4)5)11-9-6-10(16)18-12(9)19-13(11)17-8(2)15/h9,11-13H,1,6H2,2-5H3/t9-,11+,12+,13+/m1/s1 |
| InChIKey | CVVYGMDTKZGDSB-IXOXFDKPSA-N |
| XLogP | 2.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|