C21H22ClN3O5S — CID 46229315
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-methyl-3-pyridinyl)-1,3,4-thiadiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46229315) has the molecular formula C21H22ClN3O5S and a molecular weight of 463.94 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-methyl-3-pyridinyl)-1,3,4-thiadiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-methyl-3-pyridinyl)-1,3,4-thiadiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46229315 |
| Molecular Formula | C21H22ClN3O5S |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(6-methyl-3-pyridinyl)-1,3,4-thiadiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(-c2nnc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)s2)cn1 |
| InChI | InChI=1S/C21H22ClN3O5S/c1-10-2-3-12(8-23-10)21-25-24-16(31-21)7-13-6-11(4-5-14(13)22)20-19(29)18(28)17(27)15(9-26)30-20/h2-6,8,15,17-20,26-29H,7,9H2,1H3/t15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | QAAWYBXGBQHTHR-PKOFMYQESA-N |
| XLogP | 1.67 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |