About ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate
ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 46229334) has the molecular formula C15H17N3O5S
and a molecular weight of 351.38 g/mol. Its IUPAC name is ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 46229334 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C)c1/C(C)=N/NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O5S/c1-4-22-15(19)14-13(11(3)23-17-14)10(2)16-18-24(20,21)12-8-6-5-7-9-12/h5-9,18H,4H2,1-3H3/b16-10+ |
| InChIKey | MVTXUJNRRPINJH-MHWRWJLKSA-N |
| XLogP | 1.86 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate (CID 46229334) is ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate is CCOC(=O)c1noc(C)c1/C(C)=N/NS(=O)(=O)c1ccccc1.
What is the InChIKey of ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The InChIKey is MVTXUJNRRPINJH-MHWRWJLKSA-N. The full InChI is InChI=1S/C15H17N3O5S/c1-4-22-15(19)14-13(11(3)23-17-14)10(2)16-18-24(20,21)12-8-6-5-7-9-12/h5-9,18H,4H2,1-3H3/b16-10+.
What are the key properties of ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate has a molecular weight of 351.38 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(E)-N-(benzenesulfonamido)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 46229334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).