About 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea
1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea (PubChem CID 46229378) has the molecular formula C21H17Cl2FN2O2
and a molecular weight of 419.28 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea |
| PubChem CID | 46229378 |
| Molecular Formula | C21H17Cl2FN2O2 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccc(F)cc1)Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C21H17Cl2FN2O2/c22-16-10-15(20(27)19(23)11-16)13-26(12-14-6-8-17(24)9-7-14)21(28)25-18-4-2-1-3-5-18/h1-11,27H,12-13H2,(H,25,28) |
| InChIKey | HHAIRBJJFBLIDZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea?
The IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea (CID 46229378) is 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea.
What is the SMILES notation for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea?
The canonical SMILES for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea is O=C(Nc1ccccc1)N(Cc1ccc(F)cc1)Cc1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea?
The InChIKey is HHAIRBJJFBLIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl2FN2O2/c22-16-10-15(20(27)19(23)11-16)13-26(12-14-6-8-17(24)9-7-14)21(28)25-18-4-2-1-3-5-18/h1-11,27H,12-13H2,(H,25,28).
What are the key properties of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea?
1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea has a molecular weight of 419.28 g/mol, XLogP of 6.07, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-fluorophenyl)methyl]-3-phenylurea is sourced from PubChem (CID 46229378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).