About 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea
1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea (PubChem CID 46229519) has the molecular formula C21H18Cl2N2O2S
and a molecular weight of 433.36 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea |
| PubChem CID | 46229519 |
| Molecular Formula | C21H18Cl2N2O2S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea |
| SMILES | Oc1ccc(CN(Cc2cc(Cl)cc(Cl)c2O)C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O2S/c22-16-10-15(20(27)19(23)11-16)13-25(12-14-6-8-18(26)9-7-14)21(28)24-17-4-2-1-3-5-17/h1-11,26-27H,12-13H2,(H,24,28) |
| InChIKey | APBCLSCKMPCKMF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea?
The IUPAC name of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea (CID 46229519) is 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea.
What is the SMILES notation for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea?
The canonical SMILES for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea is Oc1ccc(CN(Cc2cc(Cl)cc(Cl)c2O)C(=S)Nc2ccccc2)cc1.
What is the InChIKey of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea?
The InChIKey is APBCLSCKMPCKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2N2O2S/c22-16-10-15(20(27)19(23)11-16)13-25(12-14-6-8-18(26)9-7-14)21(28)24-17-4-2-1-3-5-17/h1-11,26-27H,12-13H2,(H,24,28).
What are the key properties of 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea?
1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea has a molecular weight of 433.36 g/mol, XLogP of 5.80, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-1-[(4-hydroxyphenyl)methyl]-3-phenylthiourea is sourced from PubChem (CID 46229519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).