About (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol
(2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol (PubChem CID 46229532) has the molecular formula C20H34O3
and a molecular weight of 322.49 g/mol. Its IUPAC name is (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol.
Molecular Properties
| Compound Name | (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol |
| PubChem CID | 46229532 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol |
| SMILES | CCCCCCCC[C@H](CO)[C@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-6-10-13-19(16-21)20(22)14-15-23-17-18-11-8-7-9-12-18/h7-9,11-12,19-22H,2-6,10,13-17H2,1H3/t19-,20-/m1/s1 |
| InChIKey | QRMOODFJQAFZPW-WOJBJXKFSA-N |
| XLogP | 4.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol?
The IUPAC name of (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol (CID 46229532) is (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol.
What is the SMILES notation for (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol?
The canonical SMILES for (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol is CCCCCCCC[C@H](CO)[C@H](O)CCOCc1ccccc1.
What is the InChIKey of (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol?
The InChIKey is QRMOODFJQAFZPW-WOJBJXKFSA-N. The full InChI is InChI=1S/C20H34O3/c1-2-3-4-5-6-10-13-19(16-21)20(22)14-15-23-17-18-11-8-7-9-12-18/h7-9,11-12,19-22H,2-6,10,13-17H2,1H3/t19-,20-/m1/s1.
What are the key properties of (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol?
(2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol has a molecular weight of 322.49 g/mol, XLogP of 4.31, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-octyl-5-phenylmethoxypentane-1,3-diol is sourced from PubChem (CID 46229532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).