C40H48N2O16 — CID 46229545
N,N'-bis[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]hexanediamide (PubChem CID 46229545) has the molecular formula C40H48N2O16 and a molecular weight of 812.82 g/mol. Its IUPAC name is N,N'-bis[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]hexanediamide.
| Compound Name | N,N'-bis[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]hexanediamide |
|---|---|
| PubChem CID | 46229545 |
| Molecular Formula | C40H48N2O16 |
| Molecular Weight | 812.82 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | N,N'-bis[7-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxochromen-3-yl]hexanediamide |
| SMILES | CO[C@@H]1[C@@H](O)[C@@H](O)[C@H](Oc2ccc3cc(NC(=O)CCCCC(=O)Nc4cc5ccc(O[C@@H]6OC(C)(C)[C@H](OC)[C@@H](O)[C@H]6O)cc5oc4=O)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C40H48N2O16/c1-39(2)33(51-5)29(45)31(47)37(57-39)53-21-13-11-19-15-23(35(49)55-25(19)17-21)41-27(43)9-7-8-10-28(44)42-24-16-20-12-14-22(18-26(20)56-36(24)50)54-38-32(48)30(46)34(52-6)40(3,4)58-38/h11-18,29-34,37-38,45-48H,7-10H2,1-6H3,(H,41,43)(H,42,44)/t29-,30-,31+,32+,33+,34+,37+,38+/m0/s1 |
| InChIKey | WGVTZWPHKUZZNV-VJNHOFHRSA-N |
| XLogP | 2.54 |
| TPSA | 254.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.82 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|