C30H41NO5 — CID 46229557
(4S)-4-benzyl-3-[(2S)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]decanoyl]-1,3-oxazolidin-2-one (PubChem CID 46229557) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]decanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]decanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 46229557 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-2-[(1R)-1-hydroxy-3-phenylmethoxypropyl]decanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)CCOCc1ccccc1 |
| InChI | InChI=1S/C30H41NO5/c1-2-3-4-5-6-13-18-27(28(32)19-20-35-22-25-16-11-8-12-17-25)29(33)31-26(23-36-30(31)34)21-24-14-9-7-10-15-24/h7-12,14-17,26-28,32H,2-6,13,18-23H2,1H3/t26-,27-,28+/m0/s1 |
| InChIKey | CKEWGBITFVNKTA-HZFUHODCSA-N |
| XLogP | 5.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|