C23H38O3 — CID 46229558
(4R,5R)-2,2-dimethyl-5-octyl-4-(2-phenylmethoxyethyl)-1,3-dioxane (PubChem CID 46229558) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-5-octyl-4-(2-phenylmethoxyethyl)-1,3-dioxane.
| Compound Name | (4R,5R)-2,2-dimethyl-5-octyl-4-(2-phenylmethoxyethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 46229558 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-5-octyl-4-(2-phenylmethoxyethyl)-1,3-dioxane |
| SMILES | CCCCCCCC[C@@H]1COC(C)(C)O[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C23H38O3/c1-4-5-6-7-8-12-15-21-19-25-23(2,3)26-22(21)16-17-24-18-20-13-10-9-11-14-20/h9-11,13-14,21-22H,4-8,12,15-19H2,1-3H3/t21-,22-/m1/s1 |
| InChIKey | SVOFRWYMPCLRRH-FGZHOGPDSA-N |
| XLogP | 6.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|