About ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate
ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 46229690) has the molecular formula C10H14N4O4
and a molecular weight of 254.25 g/mol. Its IUPAC name is ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 46229690 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(C)c1/C(C)=N/NC(N)=O |
| InChI | InChI=1S/C10H14N4O4/c1-4-17-9(15)8-7(6(3)18-14-8)5(2)12-13-10(11)16/h4H2,1-3H3,(H3,11,13,16)/b12-5+ |
| InChIKey | CGMOIIHREYWZMH-LFYBBSHMSA-N |
| XLogP | 0.55 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate (CID 46229690) is ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate is CCOC(=O)c1noc(C)c1/C(C)=N/NC(N)=O.
What is the InChIKey of ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
The InChIKey is CGMOIIHREYWZMH-LFYBBSHMSA-N. The full InChI is InChI=1S/C10H14N4O4/c1-4-17-9(15)8-7(6(3)18-14-8)5(2)12-13-10(11)16/h4H2,1-3H3,(H3,11,13,16)/b12-5+.
What are the key properties of ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate?
ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate has a molecular weight of 254.25 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(E)-N-(carbamoylamino)-C-methylcarbonimidoyl]-5-methyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 46229690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).