About NEGUNDOIN D
NEGUNDOIN D (PubChem CID 46229720) has the molecular formula C23H36O6
and a molecular weight of 408.54 g/mol.
Molecular Properties
| Compound Name | NEGUNDOIN D |
| PubChem CID | 46229720 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | — |
| SMILES | CO[C@H]1OC(=O)C[C@@]12CC[C@@]1(O2)[C@H](C)CC[C@H]2C(C)(C)[C@@H](OC(C)=O)CC[C@@]21C |
| InChI | InChI=1S/C23H36O6/c1-14-7-8-16-20(3,4)17(27-15(2)24)9-10-21(16,5)23(14)12-11-22(29-23)13-18(25)28-19(22)26-6/h14,16-17,19H,7-13H2,1-6H3/t14-,16+,17+,19+,21+,22+,23-/m1/s1 |
| InChIKey | GCQMZZDJVNUQJV-WDYVTMJNSA-N |
| XLogP | 4.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze NEGUNDOIN D with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of NEGUNDOIN D?
The IUPAC name of NEGUNDOIN D (CID 46229720) is not available.
What is the SMILES notation for NEGUNDOIN D?
The canonical SMILES for NEGUNDOIN D is CO[C@H]1OC(=O)C[C@@]12CC[C@@]1(O2)[C@H](C)CC[C@H]2C(C)(C)[C@@H](OC(C)=O)CC[C@@]21C.
What is the InChIKey of NEGUNDOIN D?
The InChIKey is GCQMZZDJVNUQJV-WDYVTMJNSA-N. The full InChI is InChI=1S/C23H36O6/c1-14-7-8-16-20(3,4)17(27-15(2)24)9-10-21(16,5)23(14)12-11-22(29-23)13-18(25)28-19(22)26-6/h14,16-17,19H,7-13H2,1-6H3/t14-,16+,17+,19+,21+,22+,23-/m1/s1.
What are the key properties of NEGUNDOIN D?
NEGUNDOIN D has a molecular weight of 408.54 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for NEGUNDOIN D is sourced from PubChem (CID 46229720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).