C27H35N5O2 — CID 46229735
N-(4-ethoxy-2,5-dimethylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine (PubChem CID 46229735) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(4-ethoxy-2,5-dimethylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(4-ethoxy-2,5-dimethylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46229735 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-(4-ethoxy-2,5-dimethylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
| SMILES | CCOc1cc(C)c(Nc2ccnc(N3CCN(c4ccc(OC)cc4)C(C)(C)C3)n2)cc1C |
| InChI | InChI=1S/C27H35N5O2/c1-7-34-24-17-19(2)23(16-20(24)3)29-25-12-13-28-26(30-25)31-14-15-32(27(4,5)18-31)21-8-10-22(33-6)11-9-21/h8-13,16-17H,7,14-15,18H2,1-6H3,(H,28,29,30) |
| InChIKey | UCNRFSAPXDVXBW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|