C29H39N5O2 — CID 46229737
N-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine (PubChem CID 46229737) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46229737 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | N-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidin-4-amine |
| SMILES | CCOc1cc(C)c(Nc2ccnc(N3CCN(c4ccc(OC)cc4)C(C)(C)C3)n2)cc1C(C)C |
| InChI | InChI=1S/C29H39N5O2/c1-8-36-26-17-21(4)25(18-24(26)20(2)3)31-27-13-14-30-28(32-27)33-15-16-34(29(5,6)19-33)22-9-11-23(35-7)12-10-22/h9-14,17-18,20H,8,15-16,19H2,1-7H3,(H,30,31,32) |
| InChIKey | VNDPXVQUPZITOZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|