C21H25ClN2O2 — CID 46229764
(3S,11bS)-3-(3-chlorophenyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine (PubChem CID 46229764) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is (3S,11bS)-3-(3-chlorophenyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine.
| Compound Name | (3S,11bS)-3-(3-chlorophenyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
|---|---|
| PubChem CID | 46229764 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (3S,11bS)-3-(3-chlorophenyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-amine |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CC(N)[C@@H](c3cccc(Cl)c3)CN1CC2 |
| InChI | InChI=1S/C21H25ClN2O2/c1-25-20-9-14-6-7-24-12-17(13-4-3-5-15(22)8-13)18(23)11-19(24)16(14)10-21(20)26-2/h3-5,8-10,17-19H,6-7,11-12,23H2,1-2H3/t17-,18?,19+/m1/s1 |
| InChIKey | ZJDLPRJGRPALAH-KGNCLDLBSA-N |
| XLogP | 3.77 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |