About 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid
2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 46229938) has the molecular formula C22H21ClN2O2S
and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid |
| PubChem CID | 46229938 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(C2(c3ccccc3)CCNCC2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O2S/c23-17-8-6-15(7-9-17)20-18(14-19(26)27)28-21(25-20)22(10-12-24-13-11-22)16-4-2-1-3-5-16/h1-9,24H,10-14H2,(H,26,27) |
| InChIKey | SVOLDBJYHRIHMU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid (CID 46229938) is 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid is O=C(O)Cc1sc(C2(c3ccccc3)CCNCC2)nc1-c1ccc(Cl)cc1.
What is the InChIKey of 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid?
The InChIKey is SVOLDBJYHRIHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2O2S/c23-17-8-6-15(7-9-17)20-18(14-19(26)27)28-21(25-20)22(10-12-24-13-11-22)16-4-2-1-3-5-16/h1-9,24H,10-14H2,(H,26,27).
What are the key properties of 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid?
2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid has a molecular weight of 412.94 g/mol, XLogP of 4.76, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-2-(4-phenylpiperidin-4-yl)-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 46229938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).