C28H38N6O — CID 46229974
4-N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidine-4,6-diamine (PubChem CID 46229974) has the molecular formula C28H38N6O and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 46229974 |
| Molecular Formula | C28H38N6O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 4-N-(5-tert-butyl-2-methylphenyl)-2-[4-(4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(N2CCN(c3nc(N)cc(Nc4cc(C(C)(C)C)ccc4C)n3)CC2(C)C)cc1 |
| InChI | InChI=1S/C28H38N6O/c1-19-8-9-20(27(2,3)4)16-23(19)30-25-17-24(29)31-26(32-25)33-14-15-34(28(5,6)18-33)21-10-12-22(35-7)13-11-21/h8-13,16-17H,14-15,18H2,1-7H3,(H3,29,30,31,32) |
| InChIKey | GDEWOODTVBOLDT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|