About 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid
2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid (PubChem CID 46229992) has the molecular formula C23H17F2N3O2S
and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid |
| PubChem CID | 46229992 |
| Molecular Formula | C23H17F2N3O2S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid |
| SMILES | Nc1ccc(-c2nc(C(c3ccc(F)cc3)c3ccc(F)cc3)sc2CC(=O)O)cn1 |
| InChI | InChI=1S/C23H17F2N3O2S/c24-16-6-1-13(2-7-16)21(14-3-8-17(25)9-4-14)23-28-22(18(31-23)11-20(29)30)15-5-10-19(26)27-12-15/h1-10,12,21H,11H2,(H2,26,27)(H,29,30) |
| InChIKey | BXTPYMOEOBNFOK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid (CID 46229992) is 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid is Nc1ccc(-c2nc(C(c3ccc(F)cc3)c3ccc(F)cc3)sc2CC(=O)O)cn1.
What is the InChIKey of 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid?
The InChIKey is BXTPYMOEOBNFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N3O2S/c24-16-6-1-13(2-7-16)21(14-3-8-17(25)9-4-14)23-28-22(18(31-23)11-20(29)30)15-5-10-19(26)27-12-15/h1-10,12,21H,11H2,(H2,26,27)(H,29,30).
What are the key properties of 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid?
2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid has a molecular weight of 437.47 g/mol, XLogP of 4.87, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6-amino-3-pyridinyl)-2-[bis(4-fluorophenyl)methyl]-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 46229992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).