About 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol
2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol (PubChem CID 46230026) has the molecular formula C17H24N6O
and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol |
| PubChem CID | 46230026 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol |
| SMILES | CN1CCCN(c2nc(-c3ccncc3)cnc2NCCO)CC1 |
| InChI | InChI=1S/C17H24N6O/c1-22-8-2-9-23(11-10-22)17-16(19-7-12-24)20-13-15(21-17)14-3-5-18-6-4-14/h3-6,13,24H,2,7-12H2,1H3,(H,19,20) |
| InChIKey | QQNMOYJOWGKMCM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol?
The IUPAC name of 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol (CID 46230026) is 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol.
What is the SMILES notation for 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol?
The canonical SMILES for 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol is CN1CCCN(c2nc(-c3ccncc3)cnc2NCCO)CC1.
What is the InChIKey of 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol?
The InChIKey is QQNMOYJOWGKMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O/c1-22-8-2-9-23(11-10-22)17-16(19-7-12-24)20-13-15(21-17)14-3-5-18-6-4-14/h3-6,13,24H,2,7-12H2,1H3,(H,19,20).
What are the key properties of 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol?
2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol has a molecular weight of 328.42 g/mol, XLogP of 1.08, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-methyl-1,4-diazepan-1-yl)-5-pyridin-4-ylpyrazin-2-yl]amino]ethanol is sourced from PubChem (CID 46230026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).