C36H45N9O3 — CID 46230104
N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide (PubChem CID 46230104) has the molecular formula C36H45N9O3 and a molecular weight of 651.82 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide |
|---|---|
| PubChem CID | 46230104 |
| Molecular Formula | C36H45N9O3 |
| Molecular Weight | 651.82 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCCc4cn(C(C)C)cn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C36H45N9O3/c1-4-11-30(46)41-28-18-29(33(48)32(28)47)45-22-40-31-34(38-19-27(24-12-7-5-8-13-24)25-14-9-6-10-15-25)42-36(43-35(31)45)37-17-16-26-20-44(21-39-26)23(2)3/h5-10,12-15,20-23,27-29,32-33,47-48H,4,11,16-19H2,1-3H3,(H,41,46)(H2,37,38,42,43)/t28-,29+,32+,33-/m0/s1 |
| InChIKey | CIMXZVURQFXWNX-MLVZTVGHSA-N |
| XLogP | 4.45 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |