About [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol
[5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol (PubChem CID 46230137) has the molecular formula C16H10F6N2O3
and a molecular weight of 392.26 g/mol. Its IUPAC name is [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol |
| PubChem CID | 46230137 |
| Molecular Formula | C16H10F6N2O3 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol |
| SMILES | OCc1cc(COc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)on1 |
| InChI | InChI=1S/C16H10F6N2O3/c17-15(18,19)11-3-1-2-10-12(5-13(16(20,21)22)23-14(10)11)26-7-9-4-8(6-25)24-27-9/h1-5,25H,6-7H2 |
| InChIKey | GDDKNULSPACAGC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol (CID 46230137) is [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol is OCc1cc(COc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)on1.
What is the InChIKey of [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol?
The InChIKey is GDDKNULSPACAGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6N2O3/c17-15(18,19)11-3-1-2-10-12(5-13(16(20,21)22)23-14(10)11)26-7-9-4-8(6-25)24-27-9/h1-5,25H,6-7H2.
What are the key properties of [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol?
[5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol has a molecular weight of 392.26 g/mol, XLogP of 4.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 46230137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).