C23H28N8O3 — CID 46230151
(1R,2S,3R,5S)-3-[6-amino-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol (PubChem CID 46230151) has the molecular formula C23H28N8O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[6-amino-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[6-amino-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46230151 |
| Molecular Formula | C23H28N8O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (1R,2S,3R,5S)-3-[6-amino-2-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]-5-(4-methylpyrazol-1-yl)cyclopentane-1,2-diol |
| SMILES | Cc1cnn([C@H]2C[C@@H](n3cnc4c(N)nc(N[C@H](CO)Cc5ccccc5)nc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C23H28N8O3/c1-13-9-26-31(10-13)17-8-16(19(33)20(17)34)30-12-25-18-21(24)28-23(29-22(18)30)27-15(11-32)7-14-5-3-2-4-6-14/h2-6,9-10,12,15-17,19-20,32-34H,7-8,11H2,1H3,(H3,24,27,28,29)/t15-,16+,17-,19-,20+/m0/s1 |
| InChIKey | LKBHTUWEPYNFEX-SQIBXOBRSA-N |
| XLogP | 0.84 |
| TPSA | 160.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |