C17H22ClNO7S2 — CID 46230154
[2-chloro-6-[[3-hydroxy-4-(1,1,4-trioxo-1,2-thiazolidin-2-yl)phenyl]methyl]cyclohexyl] methanesulfonate (PubChem CID 46230154) has the molecular formula C17H22ClNO7S2 and a molecular weight of 451.95 g/mol. Its IUPAC name is [2-chloro-6-[[3-hydroxy-4-(1,1,4-trioxo-1,2-thiazolidin-2-yl)phenyl]methyl]cyclohexyl] methanesulfonate.
| Compound Name | [2-chloro-6-[[3-hydroxy-4-(1,1,4-trioxo-1,2-thiazolidin-2-yl)phenyl]methyl]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 46230154 |
| Molecular Formula | C17H22ClNO7S2 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [2-chloro-6-[[3-hydroxy-4-(1,1,4-trioxo-1,2-thiazolidin-2-yl)phenyl]methyl]cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C(Cl)CCCC1Cc1ccc(N2CC(=O)CS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C17H22ClNO7S2/c1-27(22,23)26-17-12(3-2-4-14(17)18)7-11-5-6-15(16(21)8-11)19-9-13(20)10-28(19,24)25/h5-6,8,12,14,17,21H,2-4,7,9-10H2,1H3 |
| InChIKey | YNGRFRCHJRRWBC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|