C40H45N9O3 — CID 46230241
N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-phenylacetamide (PubChem CID 46230241) has the molecular formula C40H45N9O3 and a molecular weight of 699.86 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-phenylacetamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 46230241 |
| Molecular Formula | C40H45N9O3 |
| Molecular Weight | 699.86 g/mol |
| Exact Mass | 699.36 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2-phenylacetamide |
| SMILES | CC(C)n1cnc(CCNc2nc(NCC(c3ccccc3)c3ccccc3)c3ncn([C@@H]4C[C@H](NC(=O)Cc5ccccc5)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C40H45N9O3/c1-26(2)48-23-30(43-24-48)18-19-41-40-46-38(42-22-31(28-14-8-4-9-15-28)29-16-10-5-11-17-29)35-39(47-40)49(25-44-35)33-21-32(36(51)37(33)52)45-34(50)20-27-12-6-3-7-13-27/h3-17,23-26,31-33,36-37,51-52H,18-22H2,1-2H3,(H,45,50)(H2,41,42,46,47)/t32-,33+,36+,37-/m0/s1 |
| InChIKey | XXBBLDMMOUVMOK-PNAREQLXSA-N |
| XLogP | 4.90 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |