C41H47N9O3 — CID 46230242
N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-3-phenylpropanamide (PubChem CID 46230242) has the molecular formula C41H47N9O3 and a molecular weight of 713.89 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-3-phenylpropanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 46230242 |
| Molecular Formula | C41H47N9O3 |
| Molecular Weight | 713.89 g/mol |
| Exact Mass | 713.38 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-3-phenylpropanamide |
| SMILES | CC(C)n1cnc(CCNc2nc(NCC(c3ccccc3)c3ccccc3)c3ncn([C@@H]4C[C@H](NC(=O)CCc5ccccc5)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C41H47N9O3/c1-27(2)49-24-31(44-25-49)20-21-42-41-47-39(43-23-32(29-14-8-4-9-15-29)30-16-10-5-11-17-30)36-40(48-41)50(26-45-36)34-22-33(37(52)38(34)53)46-35(51)19-18-28-12-6-3-7-13-28/h3-17,24-27,32-34,37-38,52-53H,18-23H2,1-2H3,(H,46,51)(H2,42,43,47,48)/t33-,34+,37+,38-/m0/s1 |
| InChIKey | SFJJRUJFKBGBCP-MUPSXSOUSA-N |
| XLogP | 5.29 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |