C34H40N12O2 — CID 46230245
(1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-5-(5-methyltetrazol-1-yl)cyclopentane-1,2-diol (PubChem CID 46230245) has the molecular formula C34H40N12O2 and a molecular weight of 648.78 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-5-(5-methyltetrazol-1-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-5-(5-methyltetrazol-1-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46230245 |
| Molecular Formula | C34H40N12O2 |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | (1R,2S,3R,5S)-3-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-5-(5-methyltetrazol-1-yl)cyclopentane-1,2-diol |
| SMILES | Cc1nnnn1[C@H]1C[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCCc4cn(C(C)C)cn4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H40N12O2/c1-21(2)44-18-25(37-19-44)14-15-35-34-39-32(36-17-26(23-10-6-4-7-11-23)24-12-8-5-9-13-24)29-33(40-34)45(20-38-29)27-16-28(31(48)30(27)47)46-22(3)41-42-43-46/h4-13,18-21,26-28,30-31,47-48H,14-17H2,1-3H3,(H2,35,36,39,40)/t27-,28+,30+,31-/m1/s1 |
| InChIKey | IMXHSAQVSOGNKP-HNRHMXCFSA-N |
| XLogP | 3.71 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |