C17H15F2NO3 — CID 46230259
methyl 2-[4-(acetamidomethyl)-3-fluorophenyl]-6-fluorobenzoate (PubChem CID 46230259) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 2-[4-(acetamidomethyl)-3-fluorophenyl]-6-fluorobenzoate.
| Compound Name | methyl 2-[4-(acetamidomethyl)-3-fluorophenyl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 46230259 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 2-[4-(acetamidomethyl)-3-fluorophenyl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(C)=O)c(F)c1 |
| InChI | InChI=1S/C17H15F2NO3/c1-10(21)20-9-12-7-6-11(8-15(12)19)13-4-3-5-14(18)16(13)17(22)23-2/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | XPDWLANEBFRAMZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |