C37H51NO3 — CID 46230278
[(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate (PubChem CID 46230278) has the molecular formula C37H51NO3 and a molecular weight of 557.82 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 46230278 |
| Molecular Formula | C37H51NO3 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.39 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(OC(=O)NCc3ccccc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C37H51NO3/c1-26(2)15-12-16-27(3)17-13-18-28(4)19-14-23-37(8)24-22-33-31(7)34(29(5)30(6)35(33)41-37)40-36(39)38-25-32-20-10-9-11-21-32/h9-11,15,17,19-21H,12-14,16,18,22-25H2,1-8H3,(H,38,39)/b27-17+,28-19+/t37-/m1/s1 |
| InChIKey | YHODGNNKRKVZCM-WJORMXFUSA-N |
| XLogP | 10.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|