C14H16F3N3O2S — CID 46230313
2,2-dimethyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]propanamide (PubChem CID 46230313) has the molecular formula C14H16F3N3O2S and a molecular weight of 347.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]propanamide.
| Compound Name | 2,2-dimethyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]propanamide |
|---|---|
| PubChem CID | 46230313 |
| Molecular Formula | C14H16F3N3O2S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2,2-dimethyl-N-[(Z)-[3-methyl-6-(trifluoromethoxy)-1,3-benzothiazol-2-ylidene]amino]propanamide |
| SMILES | Cn1/c(=N/NC(=O)C(C)(C)C)sc2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C14H16F3N3O2S/c1-13(2,3)11(21)18-19-12-20(4)9-6-5-8(7-10(9)23-12)22-14(15,16)17/h5-7H,1-4H3,(H,18,21)/b19-12- |
| InChIKey | GFBKUENDJAGBBX-UNOMPAQXSA-N |
| XLogP | 3.12 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|