C36H49NO3 — CID 46230322
[(2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate (PubChem CID 46230322) has the molecular formula C36H49NO3 and a molecular weight of 543.79 g/mol. Its IUPAC name is [(2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate.
| Compound Name | [(2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 46230322 |
| Molecular Formula | C36H49NO3 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | [(2R)-2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-yl] N-benzylcarbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(OC(=O)NCc3ccccc3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C36H49NO3/c1-26(2)14-11-15-27(3)16-12-17-28(4)18-13-22-36(7)23-21-32-24-33(29(5)30(6)34(32)40-36)39-35(38)37-25-31-19-9-8-10-20-31/h8-10,14,16,18-20,24H,11-13,15,17,21-23,25H2,1-7H3,(H,37,38)/b27-16+,28-18+/t36-/m1/s1 |
| InChIKey | XHQJTRZMPDEZJQ-BAAQAFCJSA-N |
| XLogP | 9.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|