C16H18Cl2F3N2O+ — CID 4623050
4-[4-[(2,6-dichlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 4623050) has the molecular formula C16H18Cl2F3N2O+ and a molecular weight of 382.23 g/mol. Its IUPAC name is 4-[4-[(2,6-dichlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | 4-[4-[(2,6-dichlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 4623050 |
| Molecular Formula | C16H18Cl2F3N2O+ |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[4-[(2,6-dichlorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | C[N+]1(Cc2c(Cl)cccc2Cl)CCN(C=CC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H18Cl2F3N2O/c1-23(11-12-13(17)3-2-4-14(12)18)9-7-22(8-10-23)6-5-15(24)16(19,20)21/h2-6H,7-11H2,1H3/q+1 |
| InChIKey | YQPSKAGJJIZFOW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|