C18H28O4 — CID 46230598
3-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propanoic acid (PubChem CID 46230598) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propanoic acid.
| Compound Name | 3-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propanoic acid |
|---|---|
| PubChem CID | 46230598 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-oxo-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=O)CC(=O)O |
| InChI | InChI=1S/C18H28O4/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-22-18(21)13-17(19)20/h7,9,11H,5-6,8,10,12-13H2,1-4H3,(H,19,20)/b15-9+,16-11+ |
| InChIKey | RLLUYKLHAUJSCD-XGGJEREUSA-N |
| XLogP | 4.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|