C20H29NO5 — CID 46230634
2-[[(2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenoyl]amino]propanedioic acid (PubChem CID 46230634) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-[[(2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenoyl]amino]propanedioic acid.
| Compound Name | 2-[[(2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenoyl]amino]propanedioic acid |
|---|---|
| PubChem CID | 46230634 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-[[(2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenoyl]amino]propanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(=O)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H29NO5/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(22)21-18(19(23)24)20(25)26/h7-8,10,12-13,18H,5-6,9,11H2,1-4H3,(H,21,22)(H,23,24)(H,25,26)/b13-7+,15-10+,16-12+ |
| InChIKey | CNYXCJMDAMZABI-YKXWRRLFSA-N |
| XLogP | 3.62 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|