C23H33NO3S — CID 46230686
(4E,8E)-N-(benzenesulfonyl)-5,9,13-trimethyltetradeca-4,8,12-trienamide (PubChem CID 46230686) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is (4E,8E)-N-(benzenesulfonyl)-5,9,13-trimethyltetradeca-4,8,12-trienamide.
| Compound Name | (4E,8E)-N-(benzenesulfonyl)-5,9,13-trimethyltetradeca-4,8,12-trienamide |
|---|---|
| PubChem CID | 46230686 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (4E,8E)-N-(benzenesulfonyl)-5,9,13-trimethyltetradeca-4,8,12-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H33NO3S/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-18-23(25)24-28(26,27)22-16-6-5-7-17-22/h5-7,11,13,15-17H,8-10,12,14,18H2,1-4H3,(H,24,25)/b20-13+,21-15+ |
| InChIKey | ADGUTYOKJQZCKI-RSKMIKRQSA-N |
| XLogP | 5.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|