C23H34N2O4 — CID 46230735
2-[(2E,6E)-3,7,11-trimethyl-1-(1-methylimidazol-2-yl)dodeca-2,6,10-trienyl]butanedioic acid (PubChem CID 46230735) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7,11-trimethyl-1-(1-methylimidazol-2-yl)dodeca-2,6,10-trienyl]butanedioic acid.
| Compound Name | 2-[(2E,6E)-3,7,11-trimethyl-1-(1-methylimidazol-2-yl)dodeca-2,6,10-trienyl]butanedioic acid |
|---|---|
| PubChem CID | 46230735 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyl-1-(1-methylimidazol-2-yl)dodeca-2,6,10-trienyl]butanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(c1nccn1C)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H34N2O4/c1-16(2)8-6-9-17(3)10-7-11-18(4)14-19(22-24-12-13-25(22)5)20(23(28)29)15-21(26)27/h8,10,12-14,19-20H,6-7,9,11,15H2,1-5H3,(H,26,27)(H,28,29)/b17-10+,18-14+ |
| InChIKey | JRUPZAMPCOXFPV-WGUKNHOESA-N |
| XLogP | 5.10 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|