C18H16ClF2N5O3 — CID 46230833
3-[(1R)-1-[5-[5-chloro-3-fluoro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea (PubChem CID 46230833) has the molecular formula C18H16ClF2N5O3 and a molecular weight of 423.81 g/mol. Its IUPAC name is 3-[(1R)-1-[5-[5-chloro-3-fluoro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea.
| Compound Name | 3-[(1R)-1-[5-[5-chloro-3-fluoro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 46230833 |
| Molecular Formula | C18H16ClF2N5O3 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-[(1R)-1-[5-[5-chloro-3-fluoro-2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-fluoro-2-pyridinyl]ethyl]-1-hydroxy-1-methylurea |
| SMILES | Cc1nc(-c2c(F)cc(Cl)cc2-c2cnc([C@@H](C)NC(=O)N(C)O)c(F)c2)no1 |
| InChI | InChI=1S/C18H16ClF2N5O3/c1-8(23-18(27)26(3)28)16-14(21)4-10(7-22-16)12-5-11(19)6-13(20)15(12)17-24-9(2)29-25-17/h4-8,28H,1-3H3,(H,23,27)/t8-/m1/s1 |
| InChIKey | LFVFDEMVFVGCTK-MRVPVSSYSA-N |
| XLogP | 4.13 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|