About 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole
1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole (PubChem CID 46230850) has the molecular formula C19H26N2O3S
and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole.
Molecular Properties
| Compound Name | 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole |
| PubChem CID | 46230850 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole |
| SMILES | CCOC(c1ccc2c(c1)OCCO2)C(SC(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-5-22-17(14-6-7-15-16(12-14)24-11-10-23-15)18(25-19(2,3)4)21-9-8-20-13-21/h6-9,12-13,17-18H,5,10-11H2,1-4H3 |
| InChIKey | CAUHKDAIFSLMRU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole?
The IUPAC name of 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole (CID 46230850) is 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole.
What is the SMILES notation for 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole?
The canonical SMILES for 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole is CCOC(c1ccc2c(c1)OCCO2)C(SC(C)(C)C)n1ccnc1.
What is the InChIKey of 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole?
The InChIKey is CAUHKDAIFSLMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O3S/c1-5-22-17(14-6-7-15-16(12-14)24-11-10-23-15)18(25-19(2,3)4)21-9-8-20-13-21/h6-9,12-13,17-18H,5,10-11H2,1-4H3.
What are the key properties of 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole?
1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole has a molecular weight of 362.50 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-tert-butylsulfanyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-ethoxyethyl]imidazole is sourced from PubChem (CID 46230850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).