About 1,3-bis(3,4-dichlorophenyl)propan-1-amine
1,3-bis(3,4-dichlorophenyl)propan-1-amine (PubChem CID 46230927) has the molecular formula C15H13Cl4N
and a molecular weight of 349.09 g/mol. Its IUPAC name is 1,3-bis(3,4-dichlorophenyl)propan-1-amine.
Molecular Properties
| Compound Name | 1,3-bis(3,4-dichlorophenyl)propan-1-amine |
| PubChem CID | 46230927 |
| Molecular Formula | C15H13Cl4N |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 1,3-bis(3,4-dichlorophenyl)propan-1-amine |
| SMILES | NC(CCc1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl4N/c16-11-4-1-9(7-13(11)18)2-6-15(20)10-3-5-12(17)14(19)8-10/h1,3-5,7-8,15H,2,6,20H2 |
| InChIKey | XYICJGKJKYWIMJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(3,4-dichlorophenyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(3,4-dichlorophenyl)propan-1-amine?
The IUPAC name of 1,3-bis(3,4-dichlorophenyl)propan-1-amine (CID 46230927) is 1,3-bis(3,4-dichlorophenyl)propan-1-amine.
What is the SMILES notation for 1,3-bis(3,4-dichlorophenyl)propan-1-amine?
The canonical SMILES for 1,3-bis(3,4-dichlorophenyl)propan-1-amine is NC(CCc1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1,3-bis(3,4-dichlorophenyl)propan-1-amine?
The InChIKey is XYICJGKJKYWIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl4N/c16-11-4-1-9(7-13(11)18)2-6-15(20)10-3-5-12(17)14(19)8-10/h1,3-5,7-8,15H,2,6,20H2.
What are the key properties of 1,3-bis(3,4-dichlorophenyl)propan-1-amine?
1,3-bis(3,4-dichlorophenyl)propan-1-amine has a molecular weight of 349.09 g/mol, XLogP of 5.93, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(3,4-dichlorophenyl)propan-1-amine is sourced from PubChem (CID 46230927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).