C24H31FN4O2 — CID 46230962
N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-N-[(3-cyclopentyloxy-4-fluorophenyl)methyl]-1-methylimidazole-4-carboxamide (PubChem CID 46230962) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-N-[(3-cyclopentyloxy-4-fluorophenyl)methyl]-1-methylimidazole-4-carboxamide.
| Compound Name | N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-N-[(3-cyclopentyloxy-4-fluorophenyl)methyl]-1-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 46230962 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-N-[(3-cyclopentyloxy-4-fluorophenyl)methyl]-1-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C(=O)N(Cc2ccc(F)c(OC3CCCC3)c2)C2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C24H31FN4O2/c1-28-14-22(27-15-28)24(30)29(19-9-17-11-26-12-18(17)10-19)13-16-6-7-21(25)23(8-16)31-20-4-2-3-5-20/h6-8,14-15,17-20,26H,2-5,9-13H2,1H3/t17-,18+,19? |
| InChIKey | CLMVMIDTRWHVDW-DFNIBXOVSA-N |
| XLogP | 3.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |