About 2-benzyl-2,3-dihydro-1H-inden-1-amine
2-benzyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 46230981) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-benzyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | 2-benzyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 46230981 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-benzyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1c2ccccc2CC1Cc1ccccc1 |
| InChI | InChI=1S/C16H17N/c17-16-14(10-12-6-2-1-3-7-12)11-13-8-4-5-9-15(13)16/h1-9,14,16H,10-11,17H2 |
| InChIKey | ROOXLJXVKMILCY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of 2-benzyl-2,3-dihydro-1H-inden-1-amine (CID 46230981) is 2-benzyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for 2-benzyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for 2-benzyl-2,3-dihydro-1H-inden-1-amine is NC1c2ccccc2CC1Cc1ccccc1.
What is the InChIKey of 2-benzyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is ROOXLJXVKMILCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N/c17-16-14(10-12-6-2-1-3-7-12)11-13-8-4-5-9-15(13)16/h1-9,14,16H,10-11,17H2.
What are the key properties of 2-benzyl-2,3-dihydro-1H-inden-1-amine?
2-benzyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 223.32 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 46230981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).