C22H30N4O2 — CID 46231012
N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-1-methyl-N-[(3-propan-2-yloxyphenyl)methyl]imidazole-4-carboxamide (PubChem CID 46231012) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-1-methyl-N-[(3-propan-2-yloxyphenyl)methyl]imidazole-4-carboxamide.
| Compound Name | N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-1-methyl-N-[(3-propan-2-yloxyphenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 46231012 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-1-methyl-N-[(3-propan-2-yloxyphenyl)methyl]imidazole-4-carboxamide |
| SMILES | CC(C)Oc1cccc(CN(C(=O)c2cn(C)cn2)C2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C22H30N4O2/c1-15(2)28-20-6-4-5-16(7-20)12-26(22(27)21-13-25(3)14-24-21)19-8-17-10-23-11-18(17)9-19/h4-7,13-15,17-19,23H,8-12H2,1-3H3/t17-,18+,19? |
| InChIKey | UTNWHVZSHUCJTA-DFNIBXOVSA-N |
| XLogP | 2.85 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |