C27H28N2O2 — CID 46231091
[[(2S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 4-methylbenzoate (PubChem CID 46231091) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 4-methylbenzoate.
| Compound Name | [[(2S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 46231091 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [[(2S,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 4-methylbenzoate |
| SMILES | C=C[C@H]1CN2CC[C@@H]1C[C@H]2C(OC(=O)c1ccc(C)cc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H28N2O2/c1-3-19-17-29-15-13-21(19)16-25(29)26(31-27(30)20-10-8-18(2)9-11-20)23-12-14-28-24-7-5-4-6-22(23)24/h3-12,14,19,21,25-26H,1,13,15-17H2,2H3/t19-,21+,25-,26?/m0/s1 |
| InChIKey | IJEDEOROYPBLGO-HDGIBXJZSA-N |
| XLogP | 5.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|