C21H17FN2O5 — CID 46231219
3-(5-fluoro-1H-indol-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione (PubChem CID 46231219) has the molecular formula C21H17FN2O5 and a molecular weight of 396.37 g/mol. Its IUPAC name is 3-(5-fluoro-1H-indol-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-fluoro-1H-indol-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 46231219 |
| Molecular Formula | C21H17FN2O5 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-(5-fluoro-1H-indol-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cc(C2=C(c3c[nH]c4ccc(F)cc34)C(=O)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H17FN2O5/c1-27-15-6-10(7-16(28-2)19(15)29-3)17-18(21(26)24-20(17)25)13-9-23-14-5-4-11(22)8-12(13)14/h4-9,23H,1-3H3,(H,24,25,26) |
| InChIKey | HRUYZDJOLIPWLW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|