C21H34O3 — CID 46231445
[(1R,3aR,4E,6R,9R,12aS)-6-hydroxy-6-methyl-10-methylidene-1-propan-2-yl-1,2,3,3a,7,8,9,11,12,12a-decahydrocyclopenta[11]annulen-9-yl] acetate (PubChem CID 46231445) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is [(1R,3aR,4E,6R,9R,12aS)-6-hydroxy-6-methyl-10-methylidene-1-propan-2-yl-1,2,3,3a,7,8,9,11,12,12a-decahydrocyclopenta[11]annulen-9-yl] acetate.
| Compound Name | [(1R,3aR,4E,6R,9R,12aS)-6-hydroxy-6-methyl-10-methylidene-1-propan-2-yl-1,2,3,3a,7,8,9,11,12,12a-decahydrocyclopenta[11]annulen-9-yl] acetate |
|---|---|
| PubChem CID | 46231445 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | [(1R,3aR,4E,6R,9R,12aS)-6-hydroxy-6-methyl-10-methylidene-1-propan-2-yl-1,2,3,3a,7,8,9,11,12,12a-decahydrocyclopenta[11]annulen-9-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@@H](C(C)C)CC[C@@H]2/C=C/[C@](C)(O)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H34O3/c1-14(2)18-9-7-17-10-12-21(5,23)13-11-20(24-16(4)22)15(3)6-8-19(17)18/h10,12,14,17-20,23H,3,6-9,11,13H2,1-2,4-5H3/b12-10+/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | XBAFJMNDOVYNFK-QHFNRRHCSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|